Organic acids and derivatives
Filtered Search Results
Ethyl tetradecanoate, 98%
CAS: 124-06-1 Molecular Formula: C16H32O2 Molecular Weight (g/mol): 256.43 MDL Number: MFCD00008984 InChI Key: MMKRHZKQPFCLLS-UHFFFAOYSA-N Synonym: ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid PubChem CID: 31283 ChEBI: CHEBI:84849 IUPAC Name: ethyl tetradecanoate SMILES: CCCCCCCCCCCCCC(=O)OCC
| PubChem CID | 31283 |
|---|---|
| CAS | 124-06-1 |
| Molecular Weight (g/mol) | 256.43 |
| ChEBI | CHEBI:84849 |
| MDL Number | MFCD00008984 |
| SMILES | CCCCCCCCCCCCCC(=O)OCC |
| Synonym | ethyl myristate,tetradecanoic acid, ethyl ester,myristic acid ethyl ester,myristic acid, ethyl ester,ethylmyristate,ethyl n-tetradecanoate,ethyl myristate natural,fema no. 2445,tetradecanoic acid ethyl ester,ethyl ester tetradecanoic acid |
| IUPAC Name | ethyl tetradecanoate |
| InChI Key | MMKRHZKQPFCLLS-UHFFFAOYSA-N |
| Molecular Formula | C16H32O2 |
5-Chloropyridine-3-boronic acid, 95%
CAS: 872041-85-5 Molecular Formula: C5H5BClNO2 Molecular Weight (g/mol): 157.36 MDL Number: MFCD06798243 InChI Key: NJXYBTMCTZAUEE-UHFFFAOYSA-N Synonym: 5-chloropyridine-3-boronic acid,5-chloropyridin-3-yl boronic acid,5-chloro-3-pyridineboronic acid,3-chloropyridine-5-boronic acid,5-chloro-3-pyridinyl boronic acid,5-chloro-3-pyridyl boronic acid,5-chloropyridin-3-yl-3-boronic acid,3-chloro-5-pyridyl boronic acid,5-chloro-3-pyridineboronicacid,pubchem17397 PubChem CID: 20111877 IUPAC Name: (5-chloropyridin-3-yl)boronic acid SMILES: OB(O)C1=CC(Cl)=CN=C1
| PubChem CID | 20111877 |
|---|---|
| CAS | 872041-85-5 |
| Molecular Weight (g/mol) | 157.36 |
| MDL Number | MFCD06798243 |
| SMILES | OB(O)C1=CC(Cl)=CN=C1 |
| Synonym | 5-chloropyridine-3-boronic acid,5-chloropyridin-3-yl boronic acid,5-chloro-3-pyridineboronic acid,3-chloropyridine-5-boronic acid,5-chloro-3-pyridinyl boronic acid,5-chloro-3-pyridyl boronic acid,5-chloropyridin-3-yl-3-boronic acid,3-chloro-5-pyridyl boronic acid,5-chloro-3-pyridineboronicacid,pubchem17397 |
| IUPAC Name | (5-chloropyridin-3-yl)boronic acid |
| InChI Key | NJXYBTMCTZAUEE-UHFFFAOYSA-N |
| Molecular Formula | C5H5BClNO2 |
Methyl 3-phenylpropionate, 98%
CAS: 103-25-3 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.204 MDL Number: MFCD00017209 InChI Key: RPUSRLKKXPQSGP-UHFFFAOYSA-N Synonym: methyl 3-phenylpropionate,methyl hydrocinnamate,benzenepropanoic acid, methyl ester,3-phenylpropionic acid methyl ester,methyl benzenepropanoate,hydrocinnamic acid, methyl ester,methyl dihydrocinnamate,methyl beta-phenylpropionate,methyl b-phenylpropionate,unii-111lc1gi10 PubChem CID: 7643 IUPAC Name: methyl 3-phenylpropanoate SMILES: COC(=O)CCC1=CC=CC=C1
| PubChem CID | 7643 |
|---|---|
| CAS | 103-25-3 |
| Molecular Weight (g/mol) | 164.204 |
| MDL Number | MFCD00017209 |
| SMILES | COC(=O)CCC1=CC=CC=C1 |
| Synonym | methyl 3-phenylpropionate,methyl hydrocinnamate,benzenepropanoic acid, methyl ester,3-phenylpropionic acid methyl ester,methyl benzenepropanoate,hydrocinnamic acid, methyl ester,methyl dihydrocinnamate,methyl beta-phenylpropionate,methyl b-phenylpropionate,unii-111lc1gi10 |
| IUPAC Name | methyl 3-phenylpropanoate |
| InChI Key | RPUSRLKKXPQSGP-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
BAPTA tetraethyl ester, 98+%
CAS: 73630-07-6 Molecular Formula: C30H40N2O10 Molecular Weight (g/mol): 588.654 MDL Number: MFCD00532663 InChI Key: OLXCPQDFHUCXBA-UHFFFAOYSA-N Synonym: bapta tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy-2,1-phenylenenitrilo tetraacetate,2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetic acid ethyl ester,ethyl 2-2-2-2-bis 2-ethoxy-2-oxidanylidene-ethyl amino phenoxy ethoxy phenyl-2-ethoxy-2-oxidanylidene-ethyl amino ethanoate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy phenyl 2-ethoxy-2-oxoethyl amino acetate PubChem CID: 339960 IUPAC Name: ethyl 2-[2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]phenoxy]ethoxy]-N-(2-ethoxy-2-oxoethyl)anilino]acetate SMILES: CCOC(=O)CN(CC(=O)OCC)C1=CC=CC=C1OCCOC2=CC=CC=C2N(CC(=O)OCC)CC(=O)OCC
| PubChem CID | 339960 |
|---|---|
| CAS | 73630-07-6 |
| Molecular Weight (g/mol) | 588.654 |
| MDL Number | MFCD00532663 |
| SMILES | CCOC(=O)CN(CC(=O)OCC)C1=CC=CC=C1OCCOC2=CC=CC=C2N(CC(=O)OCC)CC(=O)OCC |
| Synonym | bapta tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy bis 2,1-phenylene bis azanetriyl tetraacetate,1,2-bis 2-aminophenoxy ethane-n,n,n',n'-tetraacetic acid tetraethyl ester,tetraethyl 2,2',2,2'-ethane-1,2-diylbis oxy-2,1-phenylenenitrilo tetraacetate,2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetic acid ethyl ester,ethyl 2-2-2-2-bis 2-ethoxy-2-oxidanylidene-ethyl amino phenoxy ethoxy phenyl-2-ethoxy-2-oxidanylidene-ethyl amino ethanoate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy-n-2-ethoxy-2-oxoethyl anilino acetate,ethyl 2-2-2-2-bis 2-ethoxy-2-oxoethyl amino phenoxy ethoxy phenyl 2-ethoxy-2-oxoethyl amino acetate |
| IUPAC Name | ethyl 2-[2-[2-[2-[bis(2-ethoxy-2-oxoethyl)amino]phenoxy]ethoxy]-N-(2-ethoxy-2-oxoethyl)anilino]acetate |
| InChI Key | OLXCPQDFHUCXBA-UHFFFAOYSA-N |
| Molecular Formula | C30H40N2O10 |
Diethyl trichloromethylphosphonate, 98%
CAS: 866-23-9 Molecular Formula: C5H10Cl3O3P Molecular Weight (g/mol): 255.46 MDL Number: MFCD00013666 InChI Key: RVAQSYWDOSHWGP-UHFFFAOYSA-N Synonym: diethyl trichloromethylphosphonate,diethyl trichloromethyl phosphonate,phosphonic acid, trichloromethyl-, diethyl ester,methanephosphonic acid, trichloro-, diethyl ester,diethyltrichloromethylphosphonate,wln: gxggpo&o2&o2,4-03-00-00262 beilstein handbook reference,trichloromethylphosphonic acid diethyl,diethoxyphosphino trichloromethyl-1-one PubChem CID: 70085 IUPAC Name: 1-[ethoxy(trichloromethyl)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)C(Cl)(Cl)Cl
| PubChem CID | 70085 |
|---|---|
| CAS | 866-23-9 |
| Molecular Weight (g/mol) | 255.46 |
| MDL Number | MFCD00013666 |
| SMILES | CCOP(=O)(OCC)C(Cl)(Cl)Cl |
| Synonym | diethyl trichloromethylphosphonate,diethyl trichloromethyl phosphonate,phosphonic acid, trichloromethyl-, diethyl ester,methanephosphonic acid, trichloro-, diethyl ester,diethyltrichloromethylphosphonate,wln: gxggpo&o2&o2,4-03-00-00262 beilstein handbook reference,trichloromethylphosphonic acid diethyl,diethoxyphosphino trichloromethyl-1-one |
| IUPAC Name | 1-[ethoxy(trichloromethyl)phosphoryl]oxyethane |
| InChI Key | RVAQSYWDOSHWGP-UHFFFAOYSA-N |
| Molecular Formula | C5H10Cl3O3P |
1-Phenyl-1-cyclopropanecarboxylic acid, 97%
CAS: 6120-95-2 Molecular Formula: C10H10O2 Molecular Weight (g/mol): 162.19 MDL Number: MFCD00001288 InChI Key: IWWCCNVRNHTGLV-UHFFFAOYSA-N Synonym: 1-phenylcyclopropanecarboxylic acid,1-phenyl-1-cyclopropanecarboxylic acid,cyclopropanecarboxylic acid, 1-phenyl,1-phenyl-cyclopropanecarboxylic acid,1-phenyl-1-cyclopropanecarboxylicacid,pubchem15554,acmc-1b2kn,phenylcyclopropanecarboxylic acid,1-phenyl-cyclopropanecarboxlic acid,1-phenylcyclo-propanecarboxylic acid PubChem CID: 80206 IUPAC Name: 1-phenylcyclopropane-1-carboxylic acid SMILES: C1CC1(C2=CC=CC=C2)C(=O)O
| PubChem CID | 80206 |
|---|---|
| CAS | 6120-95-2 |
| Molecular Weight (g/mol) | 162.19 |
| MDL Number | MFCD00001288 |
| SMILES | C1CC1(C2=CC=CC=C2)C(=O)O |
| Synonym | 1-phenylcyclopropanecarboxylic acid,1-phenyl-1-cyclopropanecarboxylic acid,cyclopropanecarboxylic acid, 1-phenyl,1-phenyl-cyclopropanecarboxylic acid,1-phenyl-1-cyclopropanecarboxylicacid,pubchem15554,acmc-1b2kn,phenylcyclopropanecarboxylic acid,1-phenyl-cyclopropanecarboxlic acid,1-phenylcyclo-propanecarboxylic acid |
| IUPAC Name | 1-phenylcyclopropane-1-carboxylic acid |
| InChI Key | IWWCCNVRNHTGLV-UHFFFAOYSA-N |
| Molecular Formula | C10H10O2 |
3-Fluoro-4-methoxybenzeneboronic acid, 98+%
CAS: 149507-26-6 Molecular Formula: C7H8BFO3 Molecular Weight (g/mol): 169.946 MDL Number: MFCD00807404 InChI Key: IILGLPAJXQMKGQ-UHFFFAOYSA-N Synonym: 3-fluoro-4-methoxybenzeneboronic acid,3-fluoro-4-methoxyphenyl boronic acid,3-fluoro-4-methoxyphenyl boranediol,3-fluoro-4-methoxyphenylboronicacid,4-methoxy-3-fluorophenylboronic acid,boronic acid, 3-fluoro-4-methoxyphenyl,3-fluoro-4-methoxybenzeneboronicacid,pubchem1850,3-fluoro-4-methoxy-benzeneboronic acid PubChem CID: 2782194 IUPAC Name: (3-fluoro-4-methoxyphenyl)boronic acid SMILES: B(C1=CC(=C(C=C1)OC)F)(O)O
| PubChem CID | 2782194 |
|---|---|
| CAS | 149507-26-6 |
| Molecular Weight (g/mol) | 169.946 |
| MDL Number | MFCD00807404 |
| SMILES | B(C1=CC(=C(C=C1)OC)F)(O)O |
| Synonym | 3-fluoro-4-methoxybenzeneboronic acid,3-fluoro-4-methoxyphenyl boronic acid,3-fluoro-4-methoxyphenyl boranediol,3-fluoro-4-methoxyphenylboronicacid,4-methoxy-3-fluorophenylboronic acid,boronic acid, 3-fluoro-4-methoxyphenyl,3-fluoro-4-methoxybenzeneboronicacid,pubchem1850,3-fluoro-4-methoxy-benzeneboronic acid |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)boronic acid |
| InChI Key | IILGLPAJXQMKGQ-UHFFFAOYSA-N |
| Molecular Formula | C7H8BFO3 |
n-Butyl levulinate, 98%
CAS: 2052-15-5 Molecular Formula: C9H16O3 Molecular Weight (g/mol): 172.224 MDL Number: MFCD00009449 InChI Key: ISBWNEKJSSLXOD-UHFFFAOYSA-N Synonym: butyl levulinate,n-butyl levulinate,butyl laevulinate,pentanoic acid, 4-oxo-, butyl ester,n-butyl laevulinate,levulinic acid, butyl ester,butyl 4-ketovalerate,4-ketopentanoic acid butyl ester,butyl acetylpropionate,n-butyl 4-oxopentanoate PubChem CID: 16331 IUPAC Name: butyl 4-oxopentanoate SMILES: CCCCOC(=O)CCC(=O)C
| PubChem CID | 16331 |
|---|---|
| CAS | 2052-15-5 |
| Molecular Weight (g/mol) | 172.224 |
| MDL Number | MFCD00009449 |
| SMILES | CCCCOC(=O)CCC(=O)C |
| Synonym | butyl levulinate,n-butyl levulinate,butyl laevulinate,pentanoic acid, 4-oxo-, butyl ester,n-butyl laevulinate,levulinic acid, butyl ester,butyl 4-ketovalerate,4-ketopentanoic acid butyl ester,butyl acetylpropionate,n-butyl 4-oxopentanoate |
| IUPAC Name | butyl 4-oxopentanoate |
| InChI Key | ISBWNEKJSSLXOD-UHFFFAOYSA-N |
| Molecular Formula | C9H16O3 |
Thermo Scientific Chemicals Khellin, 95%
CAS: 82-02-0 Molecular Formula: C14H12O5 Molecular Weight (g/mol): 260.25 InChI Key: HSMPDPBYAYSOBC-UHFFFAOYSA-N IUPAC Name: 4,9-dimethoxy-7-methyl-5H-furo[3,2-g]chromen-5-one SMILES: COC1=C2OC=CC2=C(OC)C2=C1OC(C)=CC2=O
| CAS | 82-02-0 |
|---|---|
| Molecular Weight (g/mol) | 260.25 |
| SMILES | COC1=C2OC=CC2=C(OC)C2=C1OC(C)=CC2=O |
| IUPAC Name | 4,9-dimethoxy-7-methyl-5H-furo[3,2-g]chromen-5-one |
| InChI Key | HSMPDPBYAYSOBC-UHFFFAOYSA-N |
| Molecular Formula | C14H12O5 |
Aluminum trifluoromethanesulfonate, 99%
CAS: 74974-61-1 Molecular Formula: C3AlF9O9S3 Molecular Weight (g/mol): 474.171 MDL Number: MFCD00143596 InChI Key: FKOASGGZYSYPBI-UHFFFAOYSA-K Synonym: aluminum trifluoromethanesulfonate,aluminum triflate,aluminum triflate,aluminum tris trifluoromethanesulfonate,aluminum trifluoromethanesulphonate,aluminum 3+ tritriflate,aluminum trifluoromethanesulfonate,aluminum iii triflate,aluminum iii triflate,aluminum tris fluoranyl methanesulfonate PubChem CID: 2737634 IUPAC Name: aluminum;trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Al+3]
| PubChem CID | 2737634 |
|---|---|
| CAS | 74974-61-1 |
| Molecular Weight (g/mol) | 474.171 |
| MDL Number | MFCD00143596 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Al+3] |
| Synonym | aluminum trifluoromethanesulfonate,aluminum triflate,aluminum triflate,aluminum tris trifluoromethanesulfonate,aluminum trifluoromethanesulphonate,aluminum 3+ tritriflate,aluminum trifluoromethanesulfonate,aluminum iii triflate,aluminum iii triflate,aluminum tris fluoranyl methanesulfonate |
| IUPAC Name | aluminum;trifluoromethanesulfonate |
| InChI Key | FKOASGGZYSYPBI-UHFFFAOYSA-K |
| Molecular Formula | C3AlF9O9S3 |
Methyl 3-cyclopentenecarboxylate, 97%, Thermo Scientific Chemicals
CAS: 58101-60-3 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.16 MDL Number: MFCD04038661 InChI Key: CEOILRYKIJRPBZ-UHFFFAOYSA-N Synonym: methyl 3-cyclopentenecarboxylate,methyl cyclopent-3-enecarboxylate,methyl-3-cyclopentene-1-carboxylate,methyl3-cyclopentenecarboxylate,3-cyclopentene-1-carboxylic acid methyl ester,3-cyclopentene-1-carboxylic acid, methyl ester,acmc-209m2j,methyl cyclopent-3-ene carboxylate,4-methoxycarbonyl cyclopent-1-ene,methyl 3-cyclopentene-1-carboxylate PubChem CID: 1514118 IUPAC Name: methyl cyclopent-3-ene-1-carboxylate SMILES: COC(=O)C1CC=CC1
| PubChem CID | 1514118 |
|---|---|
| CAS | 58101-60-3 |
| Molecular Weight (g/mol) | 126.16 |
| MDL Number | MFCD04038661 |
| SMILES | COC(=O)C1CC=CC1 |
| Synonym | methyl 3-cyclopentenecarboxylate,methyl cyclopent-3-enecarboxylate,methyl-3-cyclopentene-1-carboxylate,methyl3-cyclopentenecarboxylate,3-cyclopentene-1-carboxylic acid methyl ester,3-cyclopentene-1-carboxylic acid, methyl ester,acmc-209m2j,methyl cyclopent-3-ene carboxylate,4-methoxycarbonyl cyclopent-1-ene,methyl 3-cyclopentene-1-carboxylate |
| IUPAC Name | methyl cyclopent-3-ene-1-carboxylate |
| InChI Key | CEOILRYKIJRPBZ-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
1-Cyclohexenylboronic acid, 97%
CAS: 89490-05-1 Molecular Formula: C6H11BO2 Molecular Weight (g/mol): 125.96 MDL Number: MFCD02179497 InChI Key: XZWQKJXJNKYMAP-UHFFFAOYSA-N Synonym: cyclohex-1-en-1-ylboronic acid,1-cyclohexenylboronic acid,1-cyclohexen-1-yl-boronic acid,cyclohexenylboronic acid,cyclohexen-1-yl-boronic acid,1-cyclohexen-1-ylboronic acid,cyclohexene-1-boronic acid,1-boronocyclohex-1-ene,cyclohex-1-enylboronic acid,cyclohexen-1-yl boronic acid PubChem CID: 3862902 IUPAC Name: cyclohexen-1-ylboronic acid SMILES: OB(O)C1=CCCCC1
| PubChem CID | 3862902 |
|---|---|
| CAS | 89490-05-1 |
| Molecular Weight (g/mol) | 125.96 |
| MDL Number | MFCD02179497 |
| SMILES | OB(O)C1=CCCCC1 |
| Synonym | cyclohex-1-en-1-ylboronic acid,1-cyclohexenylboronic acid,1-cyclohexen-1-yl-boronic acid,cyclohexenylboronic acid,cyclohexen-1-yl-boronic acid,1-cyclohexen-1-ylboronic acid,cyclohexene-1-boronic acid,1-boronocyclohex-1-ene,cyclohex-1-enylboronic acid,cyclohexen-1-yl boronic acid |
| IUPAC Name | cyclohexen-1-ylboronic acid |
| InChI Key | XZWQKJXJNKYMAP-UHFFFAOYSA-N |
| Molecular Formula | C6H11BO2 |
2-Aminoethyl hydrogen sulfate, 99%
CAS: 926-39-6 Molecular Formula: C2H7NO4S Molecular Weight (g/mol): 141.14 MDL Number: MFCD00008179 InChI Key: WSYUEVRAMDSJKL-UHFFFAOYSA-N Synonym: ethanolamine o-sulfate,aminoethyl sulfate,2-aminoethyl sulfate,mono 2-aminoethyl sulfate,2-aminoethyl hydrogen sulphate,sulfuric acid mono 2-aminoethyl ester,was-34,2-aminoethylhydrogensulfate,unii-9c8f910hlk,ethanol, 2-amino-, hydrogen sulfate ester PubChem CID: 70223 IUPAC Name: 2-aminoethyl hydrogen sulfate SMILES: NCCOS(O)(=O)=O
| PubChem CID | 70223 |
|---|---|
| CAS | 926-39-6 |
| Molecular Weight (g/mol) | 141.14 |
| MDL Number | MFCD00008179 |
| SMILES | NCCOS(O)(=O)=O |
| Synonym | ethanolamine o-sulfate,aminoethyl sulfate,2-aminoethyl sulfate,mono 2-aminoethyl sulfate,2-aminoethyl hydrogen sulphate,sulfuric acid mono 2-aminoethyl ester,was-34,2-aminoethylhydrogensulfate,unii-9c8f910hlk,ethanol, 2-amino-, hydrogen sulfate ester |
| IUPAC Name | 2-aminoethyl hydrogen sulfate |
| InChI Key | WSYUEVRAMDSJKL-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO4S |
Methyl alpha-chloroacrylate, 98+%, stabilized with hydroquinone
CAS: 80-63-7 Molecular Formula: C4H5ClO2 Molecular Weight (g/mol): 120.54 MDL Number: MFCD00051368 InChI Key: AWJZTPWDQYFQPQ-UHFFFAOYSA-N Synonym: methyl 2-chloroacrylate,methyl alpha-chloroacrylate,methyl-2-chloroacrylate,2-propenoic acid, 2-chloro-, methyl ester,methyl-alpha-chloroacrylate,2-chloroacrylic acid, methyl ester,methyl 2-chloro-2-propenoate,acrylic acid, 2-chloro-, methyl ester,methyl 2-chloro-2-propenate,unii-47pg4l077j PubChem CID: 6659 IUPAC Name: methyl 2-chloroprop-2-enoate SMILES: COC(=O)C(=C)Cl
| PubChem CID | 6659 |
|---|---|
| CAS | 80-63-7 |
| Molecular Weight (g/mol) | 120.54 |
| MDL Number | MFCD00051368 |
| SMILES | COC(=O)C(=C)Cl |
| Synonym | methyl 2-chloroacrylate,methyl alpha-chloroacrylate,methyl-2-chloroacrylate,2-propenoic acid, 2-chloro-, methyl ester,methyl-alpha-chloroacrylate,2-chloroacrylic acid, methyl ester,methyl 2-chloro-2-propenoate,acrylic acid, 2-chloro-, methyl ester,methyl 2-chloro-2-propenate,unii-47pg4l077j |
| IUPAC Name | methyl 2-chloroprop-2-enoate |
| InChI Key | AWJZTPWDQYFQPQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5ClO2 |
1-Hexanesulfonic acid, sodium salt hydrate, 98%, HPLC grade
CAS: 2832-45-3 Molecular Formula: C6H13NaO3S Molecular Weight (g/mol): 188.22 MDL Number: MFCD00007542 InChI Key: QWSZRRAAFHGKCH-UHFFFAOYSA-M Synonym: sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt PubChem CID: 23677630 IUPAC Name: sodium;hexane-1-sulfonate SMILES: [Na+].CCCCCCS([O-])(=O)=O
| PubChem CID | 23677630 |
|---|---|
| CAS | 2832-45-3 |
| Molecular Weight (g/mol) | 188.22 |
| MDL Number | MFCD00007542 |
| SMILES | [Na+].CCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-hexanesulfonate,sodium hexane-1-sulfonate,sodium hexanesulfonate,1-hexanesulfonic acid sodium salt,1-hexanesulfonic acid, sodium salt,1-hexanesulfonic acid, sodium salt 1:1,1-hexane sulfonic acid sodium salt,hexyl sodium sulfonate,1-hexanesulfonate, sodium,hexanesulfonic acid na-salt |
| IUPAC Name | sodium;hexane-1-sulfonate |
| InChI Key | QWSZRRAAFHGKCH-UHFFFAOYSA-M |
| Molecular Formula | C6H13NaO3S |